What is the molecular formula of N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride?
The molecular formula is C12H18ClN.
When was N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride created and modified?
It was created on 2005-08-09 and modified on 2023-12-30.
What is the IUPAC name of N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride?
The IUPAC name is (4-ethenylphenyl)methyl-trimethylazanium; chloride.
What is the InChIKey of N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride?
The InChIKey is TVXNKQRAZONMHJ-UHFFFAOYSA-M.
What is the canonical SMILES of N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride?
The canonical SMILES is C[N+](C)(C)CC1=CC=C(C=C1)C=C.[Cl-].
What is the CAS number of N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride?
The CAS number is 7538-38-7.
What is the molecular weight of N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride?
The molecular weight is 211.73 g/mol.
How many hydrogen bond donor counts are there in N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride?
There are 0 hydrogen bond donor counts.
What is the exact mass of N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride?
The exact mass is 211.1127773 g/mol.
Is the compound canonicalized for N,N,N-triMethyl-1-(4-vinylphenyl)MethanaMiniuM chloride?
Yes, the compound is canonicalized.