1-(Propyltrimethoxyl)-3-methylimidazolium chloride

• Catalog Number: ACM856925707
• Product Name: 1-(Propyltrimethoxyl)-3-methylimidazolium chloride
• CAS: 856925-70-7
• Category: Functionized Ionic Liquids
• Molecular Weight: ?282.83
• Molecular Formula: ?C10H23ClN2O3Si
• Application: Metal Plating, Electropolishing, Metal Reprocessing, Phase transfer media, Batteries Fuel Cells, Nanomaterials, Industrial Solvents, Nuclear Fuel Red Waste, Enzymatic Catalysis, Lubricants Heat Transfer and Solar Energy Conversion.
• Chemical Formula: 1-(Propyltrimethoxyl)-3-methylimidazolium chloride

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C10H21ClN2O3Si.

What are the synonyms of the compound?

The synonyms of the compound are 856925-70-7, 1-(Propyltrimethoxyl)-3-methylimidazolium chloride, 1-(3-trimethoxysilylpropyl)-3-methyl-imidazolium chloride, 1-Methyl-3-(3-(trimethoxysilyl)propyl)-1H-imidazol-3-ium chloride, trimethoxy-[3-(3-methylimidazol-3-ium-1-yl)propyl]silane;chloride.

What is the molecular weight of the compound?

The molecular weight of the compound is 280.82 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is trimethoxy-[3-(3-methylimidazol-3-ium-1-yl)propyl]silane;chloride.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C10H21N2O3Si.ClH/c1-11-7-8-12(10-11)6-5-9-16(13-2,14-3)15-4;/h7-8,10H,5-6,9H2,1-4H3;1H/q+1;/p-1.

What is the InChIKey of the compound?

The InChIKey of the compound is VBCHPEHFLCAQHA-UHFFFAOYSA-M.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is C[N+]1=CN(C=C1)CCC[Si](OC)(OC)OC.[Cl-].

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count of the compound is 0.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count of the compound is 4.

What is the rotatable bond count of the compound?

The rotatable bond count of the compound is 7.