1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate

• CAS: 503439-30-3
• Catalog Number: ACM503439303
• Category: Functionized Ionic Liquids
• Molecular Formula: C8H13N2O2.BF4

Custom Q&A

What is the molecular formula of 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

The molecular formula is C8H13BF4N2O2.

What are the synonyms for 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

The synonyms include 503439-30-3 and 1-(2-Ethoxy-2-oxoethyl)-3-methyl-1H-imidazol-3-ium tetrafluoroborate.

What is the molecular weight of 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

The molecular weight is 256.01 g/mol.

What is the IUPAC name of 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

The IUPAC name is ethyl 2-(3-methylimidazol-3-ium-1-yl)acetate; tetrafluoroborate.

What is the InChI of 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

The InChI is InChI=1S/C8H13N2O2.BF4/c1-3-12-8(11)6-10-5-4-9(2)7-10;2-1(3,4)5/h4-5,7H,3,6H2,1-2H3;/q+1;-1.

What is the InChIKey of 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

The InChIKey is ZVMHXOSQTQKSNW-UHFFFAOYSA-N.

What is the canonical SMILES of 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

The canonical SMILES is [B-](F)(F)(F)F.CCOC(=O)CN1C=C[N+](=C1)C.

What is the hydrogen bond donor count of 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

The hydrogen bond donor count is 0.

What is the hydrogen bond acceptor count of 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

The hydrogen bond acceptor count is 7.

How many rotatable bonds are present in 1-Ethyl ester methyl-3-methylimidazolium tetrafluoroborate?

There are 4 rotatable bonds present.