What is the molecular formula of ethyl 2-ethoxybenzoate?
The molecular formula of ethyl 2-ethoxybenzoate is C11H14O3.
How much does ethyl 2-ethoxybenzoate weigh?
Ethyl 2-ethoxybenzoate has a molecular weight of 194.23 g/mol.
What is the IUPAC name of ethyl 2-ethoxybenzoate?
The IUPAC name of ethyl 2-ethoxybenzoate is ethyl 2-ethoxybenzoate.
What is the InChI of ethyl 2-ethoxybenzoate?
The InChI of ethyl 2-ethoxybenzoate is InChI=1S/C11H14O3/c1-3-13-10-8-6-5-7-9(10)11(12)14-4-2/h5-8H,3-4H2,1-2H3.
What is the InChIKey of ethyl 2-ethoxybenzoate?
The InChIKey of ethyl 2-ethoxybenzoate is OUZCDRGUTZLAGO-UHFFFAOYSA-N.
What is the canonical SMILES of ethyl 2-ethoxybenzoate?
The canonical SMILES of ethyl 2-ethoxybenzoate is CCOC1=CC=CC=C1C(=O)OCC.
What is the CAS number of ethyl 2-ethoxybenzoate?
The CAS number of ethyl 2-ethoxybenzoate is 6290-24-0.
How many hydrogen bond donor counts does ethyl 2-ethoxybenzoate have?
Ethyl 2-ethoxybenzoate has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does ethyl 2-ethoxybenzoate have?
Ethyl 2-ethoxybenzoate has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does ethyl 2-ethoxybenzoate have?
Ethyl 2-ethoxybenzoate has 5 rotatable bond counts.