The molecular formula of the compound is C11H14O3.
What are the synonyms of the compound?
The synonyms of the compound are 23438-11-1, 2-methyl-2-(4-methylphenoxy)propanoic acid, 2-Methyl-2-p-tolyloxy-propionic acid, and Propionic acid, 2-methyl-2-(p-tolyloxy).
When was the compound created?
The compound was created on July 11, 2005.
When was the compound last modified?
The compound was last modified on November 25, 2023.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-methyl-2-(4-methylphenoxy)propanoic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H14O3/c1-8-4-6-9(7-5-8)14-11(2,3)10(12)13/h4-7H,1-3H3,(H,12,13).
What is the InChIKey of the compound?
The InChIKey of the compound is OQUCRQLGCRZSBH-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC1=CC=C(C=C1)OC(C)(C)C(=O)O.
What is the molecular weight of the compound?
The molecular weight of the compound is 194.23 g/mol.
Does the compound have a hydrogen bond donor count?
Yes, the compound has a hydrogen bond donor count of 1.
※ Please kindly note that our products are for research use only.