What is the molecular formula of (3-Ethoxy-4-methoxyphenyl)acetic acid?
The molecular formula is C11H14O4.
What are the synonyms of (3-Ethoxy-4-methoxyphenyl)acetic acid?
Some synonyms of (3-Ethoxy-4-methoxyphenyl)acetic acid are 714251-55-5, 2-(3-ethoxy-4-methoxyphenyl)acetic acid, (3-Ethoxy-4-methoxy-phenyl)-acetic acid, and SCHEMBL3327028.
What is the molecular weight of (3-Ethoxy-4-methoxyphenyl)acetic acid?
The molecular weight is 210.23 g/mol.
What is the IUPAC name of (3-Ethoxy-4-methoxyphenyl)acetic acid?
The IUPAC name is 2-(3-ethoxy-4-methoxyphenyl)acetic acid.
What is the InChI of (3-Ethoxy-4-methoxyphenyl)acetic acid?
The InChI is InChI=1S/C11H14O4/c1-3-15-10-6-8(7-11(12)13)4-5-9(10)14-2/h4-6H,3,7H2,1-2H3,(H,12,13).
What is the InChIKey of (3-Ethoxy-4-methoxyphenyl)acetic acid?
The InChIKey is KNQFGVWUKMDAGO-UHFFFAOYSA-N.
What is the canonical SMILES of (3-Ethoxy-4-methoxyphenyl)acetic acid?
The canonical SMILES is CCOC1=C(C=CC(=C1)CC(=O)O)OC.
What is the XLogP3 value of (3-Ethoxy-4-methoxyphenyl)acetic acid?
The XLogP3 value is 1.6.
What is the hydrogen bond donor count of (3-Ethoxy-4-methoxyphenyl)acetic acid?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of (3-Ethoxy-4-methoxyphenyl)acetic acid?
The hydrogen bond acceptor count is 4.
※ Please kindly note that our products are for research use only.