What is the PubChem CID for 3-Amino-2-phenylindenone?
PubChem CID: 291219
What is the molecular formula of 3-Amino-2-phenylindenone?
Molecular Formula: C15H11NO
What is the molecular weight of 3-Amino-2-phenylindenone?
Molecular Weight: 221.25 g/mol
What is the IUPAC name of 3-Amino-2-phenylindenone?
IUPAC Name: 3-amino-2-phenylinden-1-one
What is the InChI of 3-Amino-2-phenylindenone?
InChI: InChI=1S/C15H11NO/c16-14-11-8-4-5-9-12(11)15(17)13(14)10-6-2-1-3-7-10/h1-9H,16H2
What is the InChIKey of 3-Amino-2-phenylindenone?
InChIKey: HLEKBTIHDXNOQP-UHFFFAOYSA-N
What is the canonical SMILES of 3-Amino-2-phenylindenone?
Canonical SMILES: C1=CC=C(C=C1)C2=C(C3=CC=CC=C3C2=O)N
What is the CAS number of 3-Amino-2-phenylindenone?
CAS Number: 1947-47-3
What is the European Community (EC) number of 3-Amino-2-phenylindenone?
EC Number: 672-545-8
What is the XLogP3-AA value of 3-Amino-2-phenylindenone?
XLogP3-AA value: 2.6