What is the molecular formula of propanethioamide?
The molecular formula of propanethioamide is C3H7NS.
What is the molecular weight of propanethioamide?
The molecular weight of propanethioamide is 89.16 g/mol.
What is the IUPAC name of propanethioamide?
The IUPAC name of propanethioamide is propanethioamide.
What is the InChI of propanethioamide?
The InChI of propanethioamide is InChI=1S/C3H7NS/c1-2-3(4)5/h2H2,1H3,(H2,4,5).
What is the InChIKey of propanethioamide?
The InChIKey of propanethioamide is WPZSAUFQHYFIPG-UHFFFAOYSA-N.
What is the canonical SMILES of propanethioamide?
The canonical SMILES of propanethioamide is CCC(=S)N.
What is the CAS number of propanethioamide?
The CAS number of propanethioamide is 631-58-3.
What is the EC number of propanethioamide?
The EC number of propanethioamide is 678-504-0.
What is the DSSTox Substance ID of propanethioamide?
The DSSTox Substance ID of propanethioamide is DTXSID80375268.
Is propanethioamide a canonicalized compound?
Yes, propanethioamide is a canonicalized compound.