What is the molecular formula of 1-Benzyl indazolyl-3-carboxylic acid?
The molecular formula of 1-Benzyl indazolyl-3-carboxylic acid is C15H12N2O2.
What are the synonyms of 1-Benzyl indazolyl-3-carboxylic acid?
The synonyms of 1-Benzyl indazolyl-3-carboxylic acid include 1-Benzyl-1H-indazole-3-carboxylic acid, 41354-03-4, 1-benzylindazole-3-carboxylic Acid, and 1-Benzyl-1H-indazole-3-carboxylicacid.
What is the molecular weight of 1-Benzyl indazolyl-3-carboxylic acid?
The molecular weight of 1-Benzyl indazolyl-3-carboxylic acid is 252.27 g/mol.
What is the IUPAC name of 1-Benzyl indazolyl-3-carboxylic acid?
The IUPAC name of 1-Benzyl indazolyl-3-carboxylic acid is 1-benzylindazole-3-carboxylic acid.
What is the InChI of 1-Benzyl indazolyl-3-carboxylic acid?
The InChI of 1-Benzyl indazolyl-3-carboxylic acid is InChI=1S/C15H12N2O2/c18-15(19)14-12-8-4-5-9-13(12)17(16-14)10-11-6-2-1-3-7-11/h1-9H,10H2,(H,18,19).
What is the InChIKey of 1-Benzyl indazolyl-3-carboxylic acid?
The InChIKey of 1-Benzyl indazolyl-3-carboxylic acid is CDRCOZFGMPTGBL-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Benzyl indazolyl-3-carboxylic acid?
The canonical SMILES of 1-Benzyl indazolyl-3-carboxylic acid is C1=CC=C(C=C1)CN2C3=CC=CC=C3C(=N2)C(=O)O.
What is the CAS number of 1-Benzyl indazolyl-3-carboxylic acid?
The CAS number of 1-Benzyl indazolyl-3-carboxylic acid is 41354-03-4.
What is the ChEMBL ID of 1-Benzyl indazolyl-3-carboxylic acid?
The ChEMBL ID of 1-Benzyl indazolyl-3-carboxylic acid is CHEMBL3415691.
What is the PubChem CID of 1-Benzyl indazolyl-3-carboxylic acid?
The PubChem CID of 1-Benzyl indazolyl-3-carboxylic acid is 10562759.
※ Please kindly note that our products are for research use only.