CAS
--- Purity
---
--- Purity
---
Shopping basket
2-Methoxyethyl chloroacetate
Catalog Number
ACMA00002640
Category
Ethers
Molecular Weight
152.58
Molecular Formula
C5H8O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H225-H302-H314-H335-H413
RIDADR
NONH for all modes of transport
Symbol
GHS02
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-methoxyethyl 2-chloroacetate.
What is the molecular formula of the compound?
The molecular formula of the compound is C5H9ClO3.
What is the molecular weight of the compound?
The molecular weight of the compound is 152.57 g/mol.
What is the InChI code of the compound?
The InChI code of the compound is InChI=1S/C5H9ClO3/c1-8-2-3-9-5(7)4-6/h2-4H2,1H3.
What is the Canonical SMILES of the compound?
The Canonical SMILES of the compound is COCCOC(=O)CCl.
What is the CAS number of the compound?
The CAS number of the compound is 13361-36-9.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 679-647-1.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID20278087.
What is the XLogP3 value of the compound?
The XLogP3 value of the compound is 0.4.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Please kindly note that our products are for research use only.
Recommended Products
