What is the molecular formula of 1,3-Dimethoxyacetone?
The molecular formula of 1,3-Dimethoxyacetone is C5H10O3.
What is the molecular weight of 1,3-Dimethoxyacetone?
The molecular weight of 1,3-Dimethoxyacetone is 118.13 g/mol.
What is the IUPAC name of 1,3-Dimethoxyacetone?
The IUPAC name of 1,3-Dimethoxyacetone is 1,3-dimethoxypropan-2-one.
What is the InChI of 1,3-Dimethoxyacetone?
The InChI of 1,3-Dimethoxyacetone is InChI=1S/C5H10O3/c1-7-3-5(6)4-8-2/h3-4H2,1-2H3.
What is the InChIKey of 1,3-Dimethoxyacetone?
The InChIKey of 1,3-Dimethoxyacetone is SZVHDRLVQJXQBT-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Dimethoxyacetone?
The canonical SMILES of 1,3-Dimethoxyacetone is COCC(=O)COC.
What is the CAS number of 1,3-Dimethoxyacetone?
The CAS number of 1,3-Dimethoxyacetone is 18664-32-9.
What is the European Community (EC) number of 1,3-Dimethoxyacetone?
The European Community (EC) number of 1,3-Dimethoxyacetone is 848-209-3.
What is the XLogP3-AA value of 1,3-Dimethoxyacetone?
The XLogP3-AA value of 1,3-Dimethoxyacetone is -0.3.
Is 1,3-Dimethoxyacetone a canonicalized compound?
Yes, 1,3-Dimethoxyacetone is a canonicalized compound.