What is the PubChem CID of H-DL-Asp-OMe?
The PubChem CID of H-DL-Asp-OMe is 274177.
What is the molecular formula of H-DL-Asp-OMe?
The molecular formula of H-DL-Asp-OMe is C5H9NO4.
What are the synonyms for H-DL-Asp-OMe?
The synonyms for H-DL-Asp-OMe are 3-amino-4-methoxy-4-oxobutanoic acid, DL-Aspartic acid alpha-methyl ester, D-Aspartic acid alpha-methyl ester, and more.
What is the molecular weight of H-DL-Asp-OMe?
The molecular weight of H-DL-Asp-OMe is 147.13 g/mol.
When was H-DL-Asp-OMe created?
H-DL-Asp-OMe was created on March 26, 2005.
When was H-DL-Asp-OMe last modified?
H-DL-Asp-OMe was last modified on November 25, 2023.
What is the IUPAC name of H-DL-Asp-OMe?
The IUPAC name of H-DL-Asp-OMe is 3-amino-4-methoxy-4-oxobutanoic acid.
What is the InChI of H-DL-Asp-OMe?
The InChI of H-DL-Asp-OMe is InChI=1S/C5H9NO4/c1-10-5(9)3(6)2-4(7)8/h3H,2,6H2,1H3,(H,7,8).
What is the InChIKey of H-DL-Asp-OMe?
The InChIKey of H-DL-Asp-OMe is SWWBMHIMADRNIK-UHFFFAOYSA-N.
What is the canonical SMILES of H-DL-Asp-OMe?
The canonical SMILES of H-DL-Asp-OMe is COC(=O)C(CC(=O)O)N.