What is the molecular formula of Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?
The molecular formula is C3H3F3O4S.
What is the molecular weight of Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?
The molecular weight is 192.12 g/mol.
What are some synonyms for Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?
Some synonyms include Methyl Fluorosulfonyldifluoroacetate and Methyl difluoro(fluorosulfonyl)acetate.
What is the InChIKey for Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?
The InChIKey is GQJCAQADCPTHKN-UHFFFAOYSA-N.
What is the Canonical SMILES representation of Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?
The Canonical SMILES is COC(=O)C(F)(F)S(=O)(=O)F.
What is the CAS number for Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?
The CAS number is 680-15-9.
How many hydrogen bond acceptors does Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate have?
It has 7 hydrogen bond acceptors.
What is the topological polar surface area of Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate?
The topological polar surface area is 68.8 Å2.
How many rotatable bonds does Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate have?
It has 3 rotatable bonds.
Is Methyl 2,2-difluoro-2-(fluorosulfonyl)acetate a canonicalized compound?
Yes, the compound is canonicalized.