3,4-Dichlorobenzenesulfonyl fluoride

• CAS: 60191-50-6
• Catalog Number: ACM60191506
• Category: Other Fluorinated Organic Building Blocks
• Molecular Weight: 229.06
• Molecular Formula: C₃H₅FO₂S
• Hazard Statements: H314
• RIDADR: UN 3261 8 / PGII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 3,4-Dichlorobenzenesulfonyl fluoride?

The molecular formula is C6H3Cl2FO2S.

What is the molecular weight of 3,4-Dichlorobenzenesulfonyl fluoride?

The molecular weight is 229.06 g/mol.

What is the IUPAC name of 3,4-Dichlorobenzenesulfonyl fluoride?

The IUPAC name is 3,4-dichlorobenzenesulfonyl fluoride.

What is the Canonical SMILES of 3,4-Dichlorobenzenesulfonyl fluoride?

The Canonical SMILES is C1=CC(=C(C=C1S(=O)(=O)F)Cl)Cl.

What is the InChIKey of 3,4-Dichlorobenzenesulfonyl fluoride?

The InChIKey is MEUGNSGWAGTVDJ-UHFFFAOYSA-N.

What is the CAS number of 3,4-Dichlorobenzenesulfonyl fluoride?

The CAS number is 60191-50-6.

How many hydrogen bond acceptors does 3,4-Dichlorobenzenesulfonyl fluoride have?

It has 3 hydrogen bond acceptors.

How many rotatable bond counts does 3,4-Dichlorobenzenesulfonyl fluoride have?

It has 1 rotatable bond count.

What is the topological polar surface area of 3,4-Dichlorobenzenesulfonyl fluoride?

The topological polar surface area is 42.5 Ų.

Is 3,4-Dichlorobenzenesulfonyl fluoride a canonicalized compound?

Yes, the compound is canonicalized.