What is the molecular formula of FOR-NLE-OH?
The molecular formula of FOR-NLE-OH is C7H13NO3.
What is the molecular weight of FOR-NLE-OH?
The molecular weight of FOR-NLE-OH is 159.18 g/mol.
What is the IUPAC name of FOR-NLE-OH?
The IUPAC name of FOR-NLE-OH is (2S)-2-formamidohexanoic acid.
What is the InChI of FOR-NLE-OH?
The InChI of FOR-NLE-OH is InChI=1S/C7H13NO3/c1-2-3-4-6(7(10)11)8-5-9/h5-6H,2-4H2,1H3,(H,8,9)(H,10,11)/t6-/m0/s1.
What is the InChIKey of FOR-NLE-OH?
The InChIKey of FOR-NLE-OH is IRIJLKLYPXLQSQ-LURJTMIESA-N.
What is the canonical SMILES of FOR-NLE-OH?
The canonical SMILES of FOR-NLE-OH is CCCCC(C(=O)O)NC=O.
How many hydrogen bond donor counts are there in FOR-NLE-OH?
There are 2 hydrogen bond donor counts in FOR-NLE-OH.
How many hydrogen bond acceptor counts are there in FOR-NLE-OH?
There are 3 hydrogen bond acceptor counts in FOR-NLE-OH.
What is the topological polar surface area of FOR-NLE-OH?
The topological polar surface area of FOR-NLE-OH is 66.4Ų.
Is FOR-NLE-OH a canonicalized compound?
Yes, FOR-NLE-OH is a canonicalized compound.