What is the molecular formula of 2-cyclopentylacetamide?
The molecular formula of 2-cyclopentylacetamide is C7H13NO.
What is the molecular weight of 2-cyclopentylacetamide?
The molecular weight of 2-cyclopentylacetamide is 127.18 g/mol.
What is the IUPAC name of 2-cyclopentylacetamide?
The IUPAC name of 2-cyclopentylacetamide is 2-cyclopentylacetamide.
What is the InChI of 2-cyclopentylacetamide?
The InChI of 2-cyclopentylacetamide is InChI=1S/C7H13NO/c8-7(9)5-6-3-1-2-4-6/h6H,1-5H2,(H2,8,9).
What is the InChIKey of 2-cyclopentylacetamide?
The InChIKey of 2-cyclopentylacetamide is OXRCIXHTUHZNRY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-cyclopentylacetamide?
The canonical SMILES of 2-cyclopentylacetamide is C1CCC(C1)CC(=O)N.
What is the CAS number of 2-cyclopentylacetamide?
The CAS number of 2-cyclopentylacetamide is 933-04-0.
What is the XLogP3-AA value of 2-cyclopentylacetamide?
The XLogP3-AA value of 2-cyclopentylacetamide is 1.3.
Is 2-cyclopentylacetamide a canonicalized compound?
Yes, 2-cyclopentylacetamide is a canonicalized compound.