What is the molecular formula of (E,E)-Farnesol?
The molecular formula of (E,E)-Farnesol is C15H26O.
What is the molecular weight of (E,E)-Farnesol?
The molecular weight of (E,E)-Farnesol is 222.37 g/mol.
What is the IUPAC name of (E,E)-Farnesol?
The IUPAC name of (E,E)-Farnesol is (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol.
What are some synonyms of (E,E)-Farnesol?
Some synonyms of (E,E)-Farnesol are farnesol, trans,trans-Farnesol, and 106-28-5.
What is the InChIKey of (E,E)-Farnesol?
The InChIKey of (E,E)-Farnesol is CRDAMVZIKSXKFV-YFVJMOTDSA-N.
What is the canonical SMILES of (E,E)-Farnesol?
The canonical SMILES of (E,E)-Farnesol is CC(=CCCC(=CCCC(=CCO)C)C)C.
What is the CAS number of (E,E)-Farnesol?
The CAS number of (E,E)-Farnesol is 4602-84-0.
What is the FEMA number of (E,E)-Farnesol?
The FEMA number of (E,E)-Farnesol is 2478.
What is the KEGG ID of (E,E)-Farnesol?
The KEGG ID of (E,E)-Farnesol is C01126.
What is the Wikipedia page of (E,E)-Farnesol?
The Wikipedia page of (E,E)-Farnesol is "Farnesol".