What is the molecular formula of 4-Methylnonane?
The molecular formula of 4-Methylnonane is C10H22.
What is the molecular weight of 4-Methylnonane?
The molecular weight of 4-Methylnonane is 142.28 g/mol.
What is the IUPAC name of 4-Methylnonane?
The IUPAC name of 4-Methylnonane is 4-methylnonane.
What is the InChI of 4-Methylnonane?
The InChI of 4-Methylnonane is InChI=1S/C10H22/c1-4-6-7-9-10(3)8-5-2/h10H,4-9H2,1-3H3.
What is the InChIKey of 4-Methylnonane?
The InChIKey of 4-Methylnonane is IALRSQMWHFKJJA-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Methylnonane?
The canonical SMILES of 4-Methylnonane is CCCCCC(C)CCC.
What is the CAS number of 4-Methylnonane?
The CAS number of 4-Methylnonane is 17301-94-9.
How many rotatable bonds are present in 4-Methylnonane?
There are 6 rotatable bonds present in 4-Methylnonane.
Is 4-Methylnonane a canonicalized compound?
Yes, 4-Methylnonane is a canonicalized compound.