What is the molecular formula of bicyclohexyl?
The molecular formula of bicyclohexyl is C12H22.
What is the molecular weight of bicyclohexyl?
The molecular weight of bicyclohexyl is 166.30 g/mol.
What is the IUPAC name of bicyclohexyl?
The IUPAC name of bicyclohexyl is cyclohexylcyclohexane.
What is the InChI of bicyclohexyl?
The InChI of bicyclohexyl is InChI=1S/C12H22/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h11-12H,1-10H2.
What is the InChIKey of bicyclohexyl?
The InChIKey of bicyclohexyl is WVIIMZNLDWSIRH-UHFFFAOYSA-N.
What is the canonical SMILES of bicyclohexyl?
The canonical SMILES of bicyclohexyl is C1CCC(CC1)C2CCCCC2.
What is the CAS number of bicyclohexyl?
The CAS number of bicyclohexyl is 92-51-3.
What is the European Community (EC) number of bicyclohexyl?
The European Community (EC) number of bicyclohexyl is 202-161-4.
What is the ChEMBL ID of bicyclohexyl?
The ChEMBL ID of bicyclohexyl is CHEMBL1231413.
Can you find bicyclohexyl in the LOTUS natural products occurrence database?
Yes, bicyclohexyl is found in the LOTUS natural products occurrence database.