What is the molecular formula of 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole?
The molecular formula is C6H3ClN2S3.
When was 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole created in PubChem?
It was created on July 19, 2005.
What is the IUPAC name of 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole?
The IUPAC name is 3-chloro-5-thiophen-2-ylsulfanyl-1,2,4-thiadiazole.
What is the Canonical SMILES representation of 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole?
The Canonical SMILES is C1=CSC(=C1)SC2=NC(=NS2)Cl.
What is the molecular weight of 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole?
The molecular weight is 234.8 g/mol.
How many hydrogen bond acceptors does 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole have?
It has 5 hydrogen bond acceptors.
What is the topological polar surface area of 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole?
The topological polar surface area is 108 Ų.
Does 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole have any defined atom stereocenters?
No, it does not have any defined atom stereocenters.
How many rotatable bonds does 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole have?
It has 2 rotatable bonds.
Is 3-Chloro-5-(thiophen-2-ylthio)-1,2,4-thiadiazole a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.