The molecular formula of L-Tyrosinamide is C33H40N6O7.
When was L-Tyrosinamide created?
L-Tyrosinamide was created on August 8, 2005.
What is the computed IUPAC name of L-Tyrosinamide?
The computed IUPAC name of L-Tyrosinamide is (2S)-2-amino-N-[(2R)-1-[[(2S)-1-[[(2R)-1-[[(2S)-1-amino-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]amino]-1-oxopropan-2-yl]-3-(4-hydroxyphenyl)propanamide.
What is the InChI of L-Tyrosinamide?
The InChI of L-Tyrosinamide is InChI=1S/C33H40N6O7/c1-19(36-32(45)26(34)16-22-8-12-24(40)13-9-22)31(44)39-28(18-21-6-4-3-5-7-21)33(46)37-20(2)30(43)38-27(29(35)42)17-23-10-14-25(41)15-11-23/h3-15,19-20,26-28,40-41H,16-18,34H2,1-2H3,(H2,35,42)(H,36,45)(H,37,46)(H,38,43)(H,39,44)/t19-,20-,26+,27+,28+/m1/s1.
What is the InChIKey of L-Tyrosinamide?
The InChIKey of L-Tyrosinamide is XDRHVZLDLNGKLM-FLVVDCEDSA-N.
What is the canonical SMILES of L-Tyrosinamide?
The canonical SMILES of L-Tyrosinamide is CC(C(=O)NC(CC1=CC=CC=C1)C(=O)NC(C)C(=O)NC(CC2=CC=C(C=C2)O)C(=O)N)NC(=O)C(CC3=CC=C(C=C3)O)N.
What is the molecular weight of L-Tyrosinamide?
The molecular weight of L-Tyrosinamide is 632.7 g/mol.
What is the XLogP3 value of L-Tyrosinamide?
The XLogP3 value of L-Tyrosinamide is 0.7.
How many hydrogen bond donor counts does L-Tyrosinamide have?
L-Tyrosinamide has 8 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does L-Tyrosinamide have?
L-Tyrosinamide has 8 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.