What is the molecular formula of phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl]?
The molecular formula is C12H16ClNO2.
What is the CID (Chemical Identifier) of phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl] in PubChem?
The CID is 68451182.
When was phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl] created in PubChem?
It was created on November 30, 2012.
When was phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl] last modified in PubChem?
It was last modified on December 30, 2023.
What is the IUPAC Name of phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl]?
The IUPAC name is 2-chloro-3-[2-(methoxymethyl)pyrrolidin-1-yl]phenol.
What is the InChI (International Chemical Identifier) of phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl]?
The InChI is InChI=1S/C12H16ClNO2/c1-16-8-9-4-3-7-14(9)10-5-2-6-11(15)12(10)13/h2,5-6,9,15H,3-4,7-8H2,1H3.
What is the InChIKey of phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl]?
The InChIKey is LEKIGXUQKLGJHC-UHFFFAOYSA-N.
What is the Canonical SMILES (Simplified Molecular Input Line Entry System) of phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl]?
The Canonical SMILES is COCC1CCCN1C2=C(C(=CC=C2)O)Cl.
What is the molecular weight of phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl]?
The molecular weight is 241.71 g/mol.
What is the XLogP3-AA (Octanol/Water Partition Coefficient) value of phenol, 2-chloro-3-[2-(methoxymethyl)-1-pyrrolidinyl]?
The XLogP3-AA value is 2.7.