What is the molecular formula of 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)-?
The molecular formula is C10H12ClNO2.
What is the molecular weight of 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)-?
The molecular weight is 213.66 g/mol.
What is the IUPAC name of 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)-?
The IUPAC name is 1-(2-chloro-3-hydroxyphenyl)pyrrolidin-3-ol.
What is the InChI of 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)-?
The InChI is InChI=1S/C10H12ClNO2/c11-10-8(2-1-3-9(10)14)12-5-4-7(13)6-12/h1-3,7,13-14H,4-6H2.
What is the InChIKey of 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)-?
The InChIKey is SXOZZVSGGDJHNG-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)-?
The canonical SMILES is C1CN(CC1O)C2=C(C(=CC=C2)O)Cl.
What is the XLogP3-AA value of 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)-?
The XLogP3-AA value is 1.8.
How many hydrogen bond donor counts does 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)- have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)- have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 3-Pyrrolidinol,1-(2-chloro-3-hydroxyphenyl)- have?
It has 1 rotatable bond count.