What is the molecular formula of 5-Amino-2-naphthol?
The molecular formula of 5-Amino-2-naphthol is C10H9NO.
What is the PubChem CID of 5-Amino-2-naphthol?
The PubChem CID of 5-Amino-2-naphthol is 6865.
What is the molecular weight of 5-Amino-2-naphthol?
The molecular weight of 5-Amino-2-naphthol is 159.18 g/mol.
What is the IUPAC name of 5-Amino-2-naphthol?
The IUPAC name of 5-Amino-2-naphthol is 5-aminonaphthalen-2-ol.
What is the InChI of 5-Amino-2-naphthol?
The InChI of 5-Amino-2-naphthol is InChI=1S/C10H9NO/c11-10-3-1-2-7-6-8(12)4-5-9(7)10/h1-6,12H,11H2.
What is the InChIKey of 5-Amino-2-naphthol?
The InChIKey of 5-Amino-2-naphthol is FSBRKZMSECKELY-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Amino-2-naphthol?
The canonical SMILES of 5-Amino-2-naphthol is C1=CC2=C(C=CC(=C2)O)C(=C1)N.
What is the CAS number of 5-Amino-2-naphthol?
The CAS number of 5-Amino-2-naphthol is 86-97-5.
What is the molecular weight of 5-Amino-2-naphthol based on PubChem computation?
The molecular weight of 5-Amino-2-naphthol based on PubChem computation is 159.18 g/mol.
Is 5-Amino-2-naphthol considered as a canonicalized compound in PubChem?
Yes, 5-Amino-2-naphthol is considered as a canonicalized compound in PubChem.