What is the molecular formula of 7-Amino-1,3-naphthalenedisulfonic acid?
The molecular formula of 7-Amino-1,3-naphthalenedisulfonic acid is C10H9NO6S2.
What is the molecular weight of 7-Amino-1,3-naphthalenedisulfonic acid?
The molecular weight of 7-Amino-1,3-naphthalenedisulfonic acid is 303.3 g/mol.
What is the IUPAC name of 7-Amino-1,3-naphthalenedisulfonic acid?
The IUPAC name of 7-Amino-1,3-naphthalenedisulfonic acid is 7-aminonaphthalene-1,3-disulfonic acid.
What is the InChI of 7-Amino-1,3-naphthalenedisulfonic acid?
The InChI of 7-Amino-1,3-naphthalenedisulfonic acid is InChI=1S/C10H9NO6S2/c11-7-2-1-6-3-8(18(12,13)14)5-10(9(6)4-7)19(15,16)17/h1-5H,11H2,(H,12,13,14)(H,15,16,17).
What is the InChIKey of 7-Amino-1,3-naphthalenedisulfonic acid?
The InChIKey of 7-Amino-1,3-naphthalenedisulfonic acid is CMOLPZZVECHXKN-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Amino-1,3-naphthalenedisulfonic acid?
The canonical SMILES of 7-Amino-1,3-naphthalenedisulfonic acid is C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)S(=O)(=O)O)N.
What is the CAS number of 7-Amino-1,3-naphthalenedisulfonic acid?
The CAS number of 7-Amino-1,3-naphthalenedisulfonic acid is 86-65-7.
Does 7-Amino-1,3-naphthalenedisulfonic acid have any related CAS numbers?
Yes, 7-Amino-1,3-naphthalenedisulfonic acid has related CAS numbers, including 68213-88-7 (mono-ammonium, mono potassium salt) and 71411-80-8 (unspecified hydrochloride salt).
What is the XLogP3-AA value of 7-Amino-1,3-naphthalenedisulfonic acid?
The XLogP3-AA value of 7-Amino-1,3-naphthalenedisulfonic acid is 0.
※ Please kindly note that our products are for research use only.