What is the molecular formula of 5-Amino-2-methoxybenzotrifluoride?
The molecular formula of 5-Amino-2-methoxybenzotrifluoride is C8H8F3NO.
What is the molecular weight of 5-Amino-2-methoxybenzotrifluoride?
The molecular weight of 5-Amino-2-methoxybenzotrifluoride is 191.15 g/mol.
What is the IUPAC name of 5-Amino-2-methoxybenzotrifluoride?
The IUPAC name of 5-Amino-2-methoxybenzotrifluoride is 4-methoxy-3-(trifluoromethyl)aniline.
What is the InChI of 5-Amino-2-methoxybenzotrifluoride?
The InChI of 5-Amino-2-methoxybenzotrifluoride is InChI=1S/C8H8F3NO/c1-13-7-3-2-5(12)4-6(7)8(9,10)11/h2-4H,12H2,1H3.
What is the InChIKey of 5-Amino-2-methoxybenzotrifluoride?
The InChIKey of 5-Amino-2-methoxybenzotrifluoride is CQJCPOVTPNWVBW-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Amino-2-methoxybenzotrifluoride?
The canonical SMILES of 5-Amino-2-methoxybenzotrifluoride is COC1=C(C=C(C=C1)N)C(F)(F)F.
What other identifiers are associated with 5-Amino-2-methoxybenzotrifluoride?
The other identifiers associated with 5-Amino-2-methoxybenzotrifluoride are CAS number 393-15-7, EPA DSSTox Substance ID DTXSID60344957, and Wikidata ID Q82117116.
What is the XLogP3-AA value of 5-Amino-2-methoxybenzotrifluoride?
The XLogP3-AA value of 5-Amino-2-methoxybenzotrifluoride is 2.1.
How many hydrogen bond donor counts does 5-Amino-2-methoxybenzotrifluoride have?
5-Amino-2-methoxybenzotrifluoride has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 5-Amino-2-methoxybenzotrifluoride have?
5-Amino-2-methoxybenzotrifluoride has 5 hydrogen bond acceptor counts.
※ Please kindly note that our products are for research use only.