--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H8F3NO.
The molecular weight of the compound is 191.15 g/mol.
The IUPAC name of the compound is N-methyl-4-(trifluoromethoxy)aniline.
The InChI of the compound is InChI=1S/C8H8F3NO/c1-12-6-2-4-7(5-3-6)13-8(9,10)11/h2-5,12H,1H3.
The InChIKey of the compound is MGCCWCLGIPNIBP-UHFFFAOYSA-N.
The canonical SMILES of the compound is CNC1=CC=C(C=C1)OC(F)(F)F.
The CAS number of the compound is 41419-59-4.
The EC number of the compound is 671-218-7.
The hydrogen bond donor count of the compound is 1.
Yes, the compound is canonicalized.