4-(Chloromethyl)-2-thiazolamine

• Catalog Number: ACMA00001283
• Category: Amines
• Molecular Weight: 148.61
• Molecular Formula: C₃H₁₀ClN
• Hazard Statements: H224-H302-H314-H335
• RIDADR: UN 2735PSN1 8 / PGII
• Symbol: GHS02

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C4H5ClN2S.

What is the molecular weight of the compound?

The molecular weight of the compound is 148.61 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-(chloromethyl)-1,3-thiazol-2-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C4H5ClN2S/c5-1-3-2-8-4(6)7-3/h2H,1H2,(H2,6,7).

What is the InChIKey of the compound?

The InChIKey of the compound is QYKUGBMFPFOPNE-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1=C(N=C(S1)N)CCl.

What is the CAS number of the compound?

The CAS number of the compound is 7250-84-2.

What is the EC number of the compound?

The EC number of the compound is 675-029-0.

What is the DSSTox Substance ID of the compound?

The DSSTox Substance ID of the compound is DTXSID30275724.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.