What is the PubChem CID for 1-Isopropylhydrazine?
The PubChem CID for 1-Isopropylhydrazine is 52789.
What is the molecular formula of 1-Isopropylhydrazine?
The molecular formula of 1-Isopropylhydrazine is C3H10N2.
What is the molecular weight of 1-Isopropylhydrazine?
The molecular weight of 1-Isopropylhydrazine is 74.13 g/mol.
What is the IUPAC name of 1-Isopropylhydrazine?
The IUPAC name of 1-Isopropylhydrazine is propan-2-ylhydrazine.
What is the InChI of 1-Isopropylhydrazine?
The InChI of 1-Isopropylhydrazine is InChI=1S/C3H10N2/c1-3(2)5-4/h3,5H,4H2,1-2H3.
What is the InChIKey of 1-Isopropylhydrazine?
The InChIKey of 1-Isopropylhydrazine is KJAQRHMKLVGSCG-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Isopropylhydrazine?
The canonical SMILES of 1-Isopropylhydrazine is CC(C)NN.
What is the CAS number of 1-Isopropylhydrazine?
The CAS number of 1-Isopropylhydrazine is 2257-52-5.
What is the European Community (EC) Number of 1-Isopropylhydrazine?
The European Community (EC) Number of 1-Isopropylhydrazine is 803-525-0.
Is 1-Isopropylhydrazine a compound with defined bond stereocenter count?
No, 1-Isopropylhydrazine does not have a defined bond stereocenter count as it is 0.