What is the molecular formula of 1-Propylbutylamine?
The molecular formula is C7H17N.
What is the molecular weight of 1-Propylbutylamine?
The molecular weight is 115.22 g/mol.
What is the IUPAC name of 1-Propylbutylamine?
The IUPAC name is heptan-4-amine.
What is the InChI of 1-Propylbutylamine?
The InChI is InChI=1S/C7H17N/c1-3-5-7(8)6-4-2/h7H,3-6,8H2,1-2H3.
What is the InChIKey of 1-Propylbutylamine?
The InChIKey is CLJMMQGDJNYDER-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Propylbutylamine?
The canonical SMILES is CCCC(CCC)N.
What is the CAS number of 1-Propylbutylamine?
The CAS number is 16751-59-0.
What is the EC Number of 1-Propylbutylamine?
The EC Number is 240-814-5.
What is the DSSTox Substance ID of 1-Propylbutylamine?
The DSSTox Substance ID is DTXSID5066116.
Is 1-Propylbutylamine a canonicalized compound?
Yes, 1-Propylbutylamine is canonicalized.