What is the PubChem CID of H-Nle-ome hydrochloride?
PubChem CID 14039065.
What is the molecular formula of H-Nle-ome hydrochloride?
The molecular formula of H-Nle-ome hydrochloride is C7H16ClNO2.
What are the synonyms for H-Nle-ome hydrochloride?
The synonyms for H-Nle-ome hydrochloride include (S)-Methyl 2-aminohexanoate hydrochloride, H-NLE-OME HCL, H-Nle-OMe.HCl, and L-Norleucine methyl ester hydrochloride.
What is the molecular weight of H-Nle-ome hydrochloride?
The molecular weight of H-Nle-ome hydrochloride is 181.66 g/mol.
What is the IUPAC name of H-Nle-ome hydrochloride?
The IUPAC name of H-Nle-ome hydrochloride is methyl (2S)-2-aminohexanoate;hydrochloride.
What is the InChI of H-Nle-ome hydrochloride?
The InChI of H-Nle-ome hydrochloride is InChI=1S/C7H15NO2.ClH/c1-3-4-5-6(8)7(9)10-2;/h6H,3-5,8H2,1-2H3;1H/t6-;/m0./s1.
What is the Canonical SMILES of H-Nle-ome hydrochloride?
The Canonical SMILES of H-Nle-ome hydrochloride is CCCCC(C(=O)OC)N.Cl.
What is the CAS number of H-Nle-ome hydrochloride?
The CAS number of H-Nle-ome hydrochloride is 3844-54-0.
How many hydrogen bond donor counts does H-Nle-ome hydrochloride have?
H-Nle-ome hydrochloride has 2 hydrogen bond donor counts.