What is the molecular formula of 1-Methylcyclobutanamine?
The molecular formula of 1-Methylcyclobutanamine is C5H11N.
What is the molecular weight of 1-Methylcyclobutanamine?
The molecular weight of 1-Methylcyclobutanamine is 85.15 g/mol.
What is the IUPAC name of 1-Methylcyclobutanamine?
The IUPAC name of 1-Methylcyclobutanamine is 1-methylcyclobutan-1-amine.
What is the InChI of 1-Methylcyclobutanamine?
The InChI of 1-Methylcyclobutanamine is InChI=1S/C5H11N/c1-5(6)3-2-4-5/h2-4,6H2,1H3.
What is the InChIKey of 1-Methylcyclobutanamine?
The InChIKey of 1-Methylcyclobutanamine is ZAXBVBGWLMVNJN-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Methylcyclobutanamine?
The canonical SMILES of 1-Methylcyclobutanamine is CC1(CCC1)N.
What is the CAS number of 1-Methylcyclobutanamine?
The CAS number of 1-Methylcyclobutanamine is 40571-47-9.
What is the European Community (EC) number of 1-Methylcyclobutanamine?
The European Community (EC) number of 1-Methylcyclobutanamine is 801-490-6.
Is 1-Methylcyclobutanamine a canonicalized compound?
Yes, 1-Methylcyclobutanamine is a canonicalized compound.