The molecular formula of the compound is C5H11ClN2O2.
What are the synonyms of the compound?
The synonyms of the compound are 1262773-49-8, 3-(2-Aminoethyl)-1,3-oxazolidin-2-one hydrochloride, 3-(2-Aminoethyl)oxazolidin-2-one hydrochloride, and 2-Oxazolidinone, 3-(2-aminoethyl)-, hydrochloride (1:1).
What is the molecular weight of the compound?
The molecular weight of the compound is 166.6 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 3-(2-aminoethyl)-1,3-oxazolidin-2-one;hydrochloride.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C5H10N2O2.ClH/c6-1-2-7-3-4-9-5(7)8;/h1-4,6H2;1H.
What is the InChIKey of the compound?
The InChIKey of the compound is NOUSUYADGXGEPS-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C1COC(=O)N1CCN.Cl.
What is the CAS number of the compound?
The CAS number of the compound is 1262773-49-8.
What is the European Community number of the compound?
The European Community number of the compound is 873-737-6.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 2.
※ Please kindly note that our products are for research use only.