What is the molecular formula of Tipranavir?
The molecular formula of Tipranavir is C31H33F3N2O5S.
What is the molecular weight of Tipranavir?
The molecular weight of Tipranavir is 602.7 g/mol.
What are the synonyms for Tipranavir?
The synonyms for Tipranavir are Aptivus, PNU-140690, TPV.
What is the IUPAC name of Tipranavir?
The IUPAC name of Tipranavir is N-[3-[(1R)-1-[(2R)-4-hydroxy-6-oxo-2-(2-phenylethyl)-2-propyl-3H-pyran-5-yl]propyl]phenyl]-5-(trifluoromethyl)pyridine-2-sulfonamide.
What is the InChI of Tipranavir?
The InChI of Tipranavir is InChI=1S/C31H33F3N2O5S/c1-3-16-30(17-15-21-9-6-5-7-10-21)19-26(37)28(29(38)41-30)25(4-2)22-11-8-12-24(18-22)36-42(39,40)27-14-13-23(20-35-27)31(32,33)34/h5-14,18,20,25,36-37H,3-4,15-17,19H2,1-2H3/t25-,30-/m1/s1.
What is the InChIKey of Tipranavir?
The InChIKey of Tipranavir is SUJUHGSWHZTSEU-FYBSXPHGSA-N.
What is the canonical SMILES of Tipranavir?
The canonical SMILES of Tipranavir is CCCC1(CC(=C(C(=O)O1)C(CC)C2=CC(=CC=C2)NS(=O)(=O)C3=NC=C(C=C3)C(F)(F)F)O)CCC4=CC=CC=C4.
What is the CAS number of Tipranavir?
The CAS number of Tipranavir is 174484-41-4.
What is the UNII of Tipranavir?
The UNII of Tipranavir is ZZT404XD09.
What is the ChEMBL ID of Tipranavir?
The ChEMBL ID of Tipranavir is CHEMBL222559.