What is the PubChem CID for stigmastanol?
The PubChem CID for stigmastanol is 241572.
What is the molecular formula of stigmastanol?
The molecular formula of stigmastanol is C29H52O.
What is the molecular weight of stigmastanol?
The molecular weight of stigmastanol is 416.7 g/mol.
What are the synonyms for stigmastanol?
The synonyms for stigmastanol include sitostanol, Fucostanol, and Spinastanol.
What is the IUPAC name of stigmastanol?
The IUPAC name of stigmastanol is (3S,5S,8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
What is the InChI of stigmastanol?
The InChI of stigmastanol is InChI=1S/C29H52O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h19-27,30H,7-18H2,1-6H3/t20-,21-,22+,23+,24-,25-,26+,27+,28+,29-/m1/s1.
What is the canonical SMILES of stigmastanol?
The canonical SMILES of stigmastanol is CCC(CCC(C)C1CCC2C1(CCC3C2CCC4C3(CCC(C4)O)C)C)C(C)C.
What is the CAS number for stigmastanol?
The CAS number for stigmastanol is 83-45-4.
What is the European Community (EC) number for stigmastanol?
The European Community (EC) number for stigmastanol is 201-479-0.
What is the Wikipedia page for stigmastanol?
The Wikipedia page for stigmastanol can be found at Stigmastanol.