What is the molecular formula of Lamotrigine-13C3,D3?
The molecular formula is C9H7Cl2N5.
What are some synonyms for Lamotrigine-13C3,D3?
Some synonyms include Lamotrigine-13C-d3, HY-B0495S, and DTXSID80849636.
What is the molecular weight of Lamotrigine-13C3,D3?
The molecular weight is 262.09 g/mol.
When was Lamotrigine-13C3,D3 created?
Lamotrigine-13C3,D3 was created on May 22, 2013.
When was Lamotrigine-13C3,D3 last modified?
Lamotrigine-13C3,D3 was last modified on October 21, 2023.
What is the IUPAC name of Lamotrigine-13C3,D3?
The IUPAC name is 6-(2,3-dichloro-4,5,6-trideuteriophenyl)-(3,5,6-13C3)1,2,4-triazine-3,5-diamine.
What is the InChI of Lamotrigine-13C3,D3?
The InChI is InChI=1S/C9H7Cl2N5/c10-5-3-1-2-4(6(5)11)7-8(12)14-9(13)16-15-7/h1-3H,(H4,12,13,14,16)/i1D,2D,3D,7+1,8+1,9+1.
What is the InChIKey of Lamotrigine-13C3,D3?
The InChIKey is PYZRQGJRPPTADH-MKOZQUTQSA-N.
What is the canonical SMILES representation of Lamotrigine-13C3,D3?
The canonical SMILES is C1=CC(=C(C(=C1)Cl)Cl)C2=C(N=C(N=N2)N).
What is the CAS number of Lamotrigine-13C3,D3?
The CAS number is 1246815-13-3.