What is the molecular formula of Salmeterol ep impurity d?
The molecular formula of Salmeterol ep impurity d is C34H47NO7.
What is the molecular weight of Salmeterol ep impurity d?
The molecular weight of Salmeterol ep impurity d is 581.7 g/mol.
When was Salmeterol ep impurity d created?
Salmeterol ep impurity d was created on August 20, 2012.
When was Salmeterol ep impurity d last modified?
Salmeterol ep impurity d was last modified on December 30, 2023.
What is the IUPAC name of Salmeterol ep impurity d?
The IUPAC name of Salmeterol ep impurity d is 4-[1-hydroxy-2-[2-(hydroxymethyl)-4-[1-hydroxy-2-[6-(4-phenylbutoxy)hexylamino]ethyl]phenoxy]ethyl]-2-(hydroxymethyl)phenol.
What is the InChI of Salmeterol ep impurity d?
The InChI of Salmeterol ep impurity d is InChI=1S/C34H47NO7/c36-23-29-20-28(13-15-31(29)38)33(40)25-42-34-16-14-27(21-30(34)24-37)32(39)22-35-17-7-1-2-8-18-41-19-9-6-12-26-10-4-3-5-11-26/h3-5,10-11,13-16,20-21,32-33,35-40H,1-2,6-9,12,17-19,22-25H2.
What is the InChIKey of Salmeterol ep impurity d?
The InChIKey of Salmeterol ep impurity d is ZHRQOSRFSAZSAM-UHFFFAOYSA-N.
What is the canonical SMILES of Salmeterol ep impurity d?
The canonical SMILES of Salmeterol ep impurity d is C1=CC=C(C=C1)CCCCOCCCCCCNCC(C2=CC(=C(C=C2)OCC(C3=CC(=C(C=C3)O)CO)O)CO)O.
What is the CAS number of Salmeterol ep impurity d?
The CAS number of Salmeterol ep impurity d is 1391052-04-2.
Is Salmeterol ep impurity d a canonicalized compound?
Yes, Salmeterol ep impurity d is a canonicalized compound according to PubChem.