What is the molecular formula of Tris[3,5-bis(trifluoromethyl)phenyl]phosphine?
The molecular formula is C24H9F18P.
When was Tris[3,5-bis(trifluoromethyl)phenyl]phosphine first created and last modified?
It was first created on July 19, 2005, and last modified on December 30, 2023.
What is the IUPAC name of Tris[3,5-bis(trifluoromethyl)phenyl]phosphine?
The IUPAC name is tris[3,5-bis(trifluoromethyl)phenyl]phosphane.
What is the InChI of Tris[3,5-bis(trifluoromethyl)phenyl]phosphine?
The InChI is InChI=1S/C24H9F18P/c25-19(26,27)10-1-11(20(28,29)30)5-16(4-10)43(17-6-12(21(31,32)33)2-13(7-17)22(34,35)36)18-8-14(23(37,38)39)3-15(9-18)24(40,41)42/h1-9H.
What is the Canonical SMILES of Tris[3,5-bis(trifluoromethyl)phenyl]phosphine?
The Canonical SMILES is C1=C(C=C(C=C1C(F)(F)F)P(C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F)C(F)(F)F.
What is the CAS number of Tris[3,5-bis(trifluoromethyl)phenyl]phosphine?
The CAS number is 175136-62-6.
What is the molecular weight of Tris[3,5-bis(trifluoromethyl)phenyl]phosphine?
The molecular weight is 670.3 g/mol.
How many hydrogen bond acceptors does Tris[3,5-bis(trifluoromethyl)phenyl]phosphine have?
It has 18 hydrogen bond acceptors.
What is the topological polar surface area of Tris[3,5-bis(trifluoromethyl)phenyl]phosphine?
The topological polar surface area is 0^2.
Does Tris[3,5-bis(trifluoromethyl)phenyl]phosphine have any defined or undefined atom or bond stereocenters?
No, it does not have any defined or undefined atom or bond stereocenters.
※ Please kindly note that our products are for research use only.