What is the molecular formula of Phenyl salicylate?
The molecular formula of Phenyl salicylate is C13H10O3.
What are some synonyms of Phenyl salicylate?
Some synonyms of Phenyl salicylate include Salol, Phenol salicylate, and Phenyl 2-Hydroxybenzoate.
What is the molecular weight of Phenyl salicylate?
The molecular weight of Phenyl salicylate is 214.22 g/mol.
How is Phenyl salicylate formed?
Phenyl salicylate can be formed by heating salicylic acid with phenol.
What role does Phenyl salicylate play in manufacturing?
Phenyl salicylate is used in the manufacture of some polymers, lacquers, adhesives, waxes, and polishes.
What is the chemical structure of Phenyl salicylate?
The chemical structure of Phenyl salicylate is C1=CC=C(C=C1)OC(=O)C2=CC=CC=C2O.
What is the IUPAC name of Phenyl salicylate?
The IUPAC name of Phenyl salicylate is phenyl 2-hydroxybenzoate.
What are some other identifiers for Phenyl salicylate?
Some other identifiers for Phenyl salicylate include CAS number 118-55-8 and ChEBI ID CHEBI:34918.
What are some physical and chemical properties of Phenyl salicylate?
Some computed properties of Phenyl salicylate include a hydrogen bond donor count of 1, a hydrogen bond acceptor count of 3, and a topological polar surface area of 46.5Ų.
How is Phenyl salicylate used in pharmaceutical products?
Phenyl salicylate is used as a mild analgesic for pain relief in some pharmaceutical products by releasing salicylate.