What is the molecular formula of N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The molecular formula is C12H30N2O3Si.
What are the synonyms for N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The synonyms are 51895-58-0, N-(6-AMINOHEXYL)AMINOPROPYLTRIMETHOXYSILANE, N'-(3-trimethoxysilylpropyl)hexane-1,6-diamine, N1-(3-(trimethoxysilyl)propyl)hexane-1,6-diamine, and 6-Aminohexyl-3-aminopropyl trimethoxysilane.
What is the molecular weight of N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The molecular weight is 278.46 g/mol.
What is the IUPAC name of N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The IUPAC name is N'-(3-trimethoxysilylpropyl)hexane-1,6-diamine.
What is the InChI of N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The InChI is InChI=1S/C12H30N2O3Si/c1-15-18(16-2,17-3)12-8-11-14-10-7-5-4-6-9-13/h14H,4-13H2,1-3H3.
What is the InChIKey of N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The InChIKey is AMVXVPUHCLLJRE-UHFFFAOYSA-N.
What is the canonical SMILES of N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The canonical SMILES is CO[Si](CCCNCCCCCCN)(OC)OC.
What is the CAS number of N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The CAS number is 51895-58-0.
What is the EC number of N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The EC number is 834-913-8.
What is the monoisotopic mass of N-(6-Aminohexyl)aminopropyltrimethoxysilane?
The monoisotopic mass is 278.20256936 g/mol.
※ Please kindly note that our products are for research use only.