What is the PubChem CID of Diphenyliodonium p-toluenesulfonate?
PubChem CID 22723
What is the molecular formula of Diphenyliodonium p-toluenesulfonate?
The molecular formula is C19H17IO3S.
What are the synonyms of Diphenyliodonium p-toluenesulfonate?
The synonyms include Diphenyliodonium p-toluenesulfonate, Diphenyliodonium 4-methylbenzenesulfonate, IODONIUM, DIPHENYL-, p-TOLUENESULFONATE, diphenyliodanium;4-methylbenzenesulfonate, etc.
What is the molecular weight of Diphenyliodonium p-toluenesulfonate?
The molecular weight is 452.3 g/mol.
What are the component compounds of Diphenyliodonium p-toluenesulfonate?
The component compounds are Diphenyliodonium (CID 12877) and p-Toluenesulfonic acid (CID 6101).
What is the IUPAC name of Diphenyliodonium p-toluenesulfonate?
The IUPAC name is diphenyliodanium;4-methylbenzenesulfonate.
What is the InChI of Diphenyliodonium p-toluenesulfonate?
The InChI is InChI=1S/C12H10I.C7H8O3S/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-6-2-4-7(5-3-6)11(8,9)10/h1-10H;2-5H,1H3,(H,8,9,10)/q+1;/p-1.
What is the InChIKey of Diphenyliodonium p-toluenesulfonate?
The InChIKey is UMIKAXKFQJWKCV-UHFFFAOYSA-M.
What is the Canonical SMILES of Diphenyliodonium p-toluenesulfonate?
The Canonical SMILES is CC1=CC=C(C=C1)S(=O)(=O)[O-].C1=CC=C(C=C1)[I+]C2=CC=CC=C2.
What is the CAS number of Diphenyliodonium p-toluenesulfonate?
The CAS number is 6293-66-9.
※ Please kindly note that our products are for research use only.