What is the molecular formula of 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine?
The molecular formula is C7H8BrN3.
How much does 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine weigh?
It weighs 214.06 g/mol.
What is the IUPAC name of 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine?
The IUPAC name is 6-bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine.
What is the InChI of 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine?
The InChI is InChI=1S/C7H8BrN3/c8-5-3-6(9)7-10-1-2-11(7)4-5/h1-3,10H,4,9H2.
What is the InChIKey of 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine?
The InChIKey is JFGWXNCELIMPCD-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine?
The canonical SMILES is C1C(=CC(=C2N1C=CN2)N)Br.
How many hydrogen bond donor counts does 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine have?
It has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine have?
It has 0 rotatable bond counts.
What is the topological polar surface area of 6-Bromo-1,5-dihydroimidazo[1,2-a]pyridin-8-amine?
The topological polar surface area is 41.3Ų.