3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid

• CAS: 332099-36-2
• Catalog Number: ACM332099362
• Category: Bromine Series
• Molecular Weight: 246.08
• Molecular Formula: C₇H₄BrNO₂S
• Synonyms: 3-BROMO-4(H)-THIENO[3,2-B]PYRROLE-5-CARBOXYLICACID

Custom Q&A

What is the molecular formula of 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?

The molecular formula is C7H4BrNO2S.

What is the molecular weight of 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?

The molecular weight is 246.08 g/mol.

What is the IUPAC name of 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?

The IUPAC name is 3-bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid.

What is the CAS number of 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?

The CAS number is 332099-36-2.

What is the InChI of 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?

The InChI is InChI=1S/C7H4BrNO2S/c8-3-2-12-5-1-4(7(10)11)9-6(3)5/h1-2,9H,(H,10,11).

What is the InChIKey of 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?

The InChIKey is WQGQGYADKDKACG-UHFFFAOYSA-N.

What is the XLogP3-AA value of 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid?

The XLogP3-AA value is 2.4.

How many hydrogen bond donor counts does 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid have?

It has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 3-Bromo-4H-thieno[3,2-b]pyrrole-5-carboxylic acid have?

It has 1 rotatable bond count.