179538-58-0 Purity
---
If you have any other questions or need other size, please get a quote.
The molecular formula of the compound is C6H7BFNO2.
The molecular weight of the compound is 154.94 g/mol.
The IUPAC name of the compound is (3-amino-4-fluorophenyl)boronic acid.
The InChI of the compound is InChI=1S/C6H7BFNO2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H,9H2.
The InChIKey of the compound is SYBMNJPUZMUPGQ-UHFFFAOYSA-N.
The canonical SMILES representation of the compound is B(C1=CC(=C(C=C1)F)N)(O)O.
The CAS number of the compound is 873566-75-7.
The EC number of the compound is 689-890-5.
The hydrogen bond donor count of the compound is 3.
The hydrogen bond acceptor count of the compound is 4.
Please kindly note that our products are for research use only.
Download