What is the molecular formula of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?
The molecular formula is C10H10Br2O.
What is the molecular weight of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?
The molecular weight is 305.99 g/mol.
What is the IUPAC name of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?
The IUPAC name is 2-bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone.
What is the InChI of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?
The InChI is InChI=1S/C10H10Br2O/c1-6-3-7(2)10(8(12)4-6)9(13)5-11/h3-4H,5H2,1-2H3.
What is the InChIKey of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?
The InChIKey is XZTGWLXJXCOBJM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?
The canonical SMILES is CC1=CC(=C(C(=C1)Br)C(=O)CBr)C.
What is the CAS number of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?
The CAS number is 1246471-30-6.
What is the XLogP3-AA value of 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone?
The XLogP3-AA value is 3.8.
How many hydrogen bond donor counts does 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2-Bromo-1-(2-bromo-4,6-dimethylphenyl)ethanone have?
It has 1 hydrogen bond acceptor count.