957120-81-9 Purity
98%
If you have any other questions or need other size, please get a quote.
The molecular formula of 2,4-Dichloro-3-cyanophenylboronic acid is C7H4BCl2NO2.
The molecular weight of 2,4-Dichloro-3-cyanophenylboronic acid is 215.83 g/mol.
The IUPAC name of 2,4-Dichloro-3-cyanophenylboronic acid is (2,4-dichloro-3-cyanophenyl)boronic acid.
The InChI of 2,4-Dichloro-3-cyanophenylboronic acid is InChI=1S/C7H4BCl2NO2/c9-6-2-1-5(8(12)13)7(10)4(6)3-11/h1-2,12-13H.
The InChIKey of 2,4-Dichloro-3-cyanophenylboronic acid is FFNJVSXDMXUODJ-UHFFFAOYSA-N.
The canonical SMILES of 2,4-Dichloro-3-cyanophenylboronic acid is B(C1=C(C(=C(C=C1)Cl)C#N)Cl)(O)O.
The CAS number of 2,4-Dichloro-3-cyanophenylboronic acid is 957120-87-5.
The hydrogen bond donor count of 2,4-Dichloro-3-cyanophenylboronic acid is 2.
The hydrogen bond acceptor count of 2,4-Dichloro-3-cyanophenylboronic acid is 3.
Yes, 2,4-Dichloro-3-cyanophenylboronic acid is canonicalized.
Please kindly note that our products are for research use only.
Download