What is the molecular formula of N-Methylisoamylamine?
The molecular formula of N-Methylisoamylamine is C6H15N.
What is the molecular weight of N-Methylisoamylamine?
The molecular weight of N-Methylisoamylamine is 101.19 g/mol.
What is the IUPAC name of N-Methylisoamylamine?
The IUPAC name of N-Methylisoamylamine is N,3-dimethylbutan-1-amine.
What is the InChI of N-Methylisoamylamine?
The InChI of N-Methylisoamylamine is InChI=1S/C6H15N/c1-6(2)4-5-7-3/h6-7H,4-5H2,1-3H3.
What is the InChIKey of N-Methylisoamylamine?
The InChIKey of N-Methylisoamylamine is QSOCODZVGPDGDA-UHFFFAOYSA-N.
What is the canonical SMILES of N-Methylisoamylamine?
The canonical SMILES of N-Methylisoamylamine is CC(C)CCNC.
What is the CAS number of N-Methylisoamylamine?
The CAS number of N-Methylisoamylamine is 4104-44-3.
What is the European Community (EC) number of N-Methylisoamylamine?
The European Community (EC) number of N-Methylisoamylamine is 803-807-3.
What is the DSSTox Substance ID of N-Methylisoamylamine?
The DSSTox Substance ID of N-Methylisoamylamine is DTXSID00334534.
Is N-Methylisoamylamine a canonicalized compound?
Yes, N-Methylisoamylamine is a canonicalized compound.