N-Benzyl-N-(2-quinolinylmethyl)formamide

• CAS: 849798-00-1
• Catalog Number: ACM849798001-2
• Category: Quinolines
• Molecular Weight: 276.33
• Molecular Formula: C18H16N2O
• Melting Point: 57-62 °C
• Appearance: White to Tan; Powder or Crystals
• Storage: room temperature

Custom Q&A

What is the molecular formula of N-Benzyl-N-(2-quinolinylmethyl)formamide?

The molecular formula is C18H16N2O.

What is the molecular weight of N-Benzyl-N-(2-quinolinylmethyl)formamide?

The molecular weight is 276.3 g/mol.

What is the IUPAC name of N-Benzyl-N-(2-quinolinylmethyl)formamide?

The IUPAC name is N-benzyl-N-(quinolin-2-ylmethyl)formamide.

What is the InChI of N-Benzyl-N-(2-quinolinylmethyl)formamide?

The InChI is InChI=1S/C18H16N2O/c21-14-20(12-15-6-2-1-3-7-15)13-17-11-10-16-8-4-5-9-18(16)19-17/h1-11,14H,12-13H2.

How many hydrogen bond donor counts are there in N-Benzyl-N-(2-quinolinylmethyl)formamide?

There are 0 hydrogen bond donor counts.

What is the topological polar surface area of N-Benzyl-N-(2-quinolinylmethyl)formamide?

The topological polar surface area is 33.2 Ų.

How many heavy atoms are there in N-Benzyl-N-(2-quinolinylmethyl)formamide?

There are 21 heavy atoms.

Is the compound N-Benzyl-N-(2-quinolinylmethyl)formamide canonicalized?

Yes, the compound is canonicalized.

What is the formal charge of N-Benzyl-N-(2-quinolinylmethyl)formamide?

The formal charge is 0.

What is the complexity value of N-Benzyl-N-(2-quinolinylmethyl)formamide?

The complexity value is 327.