CAS
31694-55-0 Purity
95%
31694-55-0 Purity
95%
Inquiry Basket
Hexakis(bromomethyl)benzene
CAS
3095-73-6
Catalog Number
ACM3095736
Category
Main Products
Molecular Weight
635.65
Molecular Formula
C6(CH2Br)6
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Hexakis(bromomethyl)benzene?
The molecular formula of Hexakis(bromomethyl)benzene is C12H12Br6.
When was Hexakis(bromomethyl)benzene created in PubChem?
Hexakis(bromomethyl)benzene was created in PubChem on 2005-03-26.
What is the IUPAC name of Hexakis(bromomethyl)benzene?
The IUPAC name of Hexakis(bromomethyl)benzene is 1,2,3,4,5,6-hexakis(bromomethyl)benzene.
What is the molecular weight of Hexakis(bromomethyl)benzene?
The molecular weight of Hexakis(bromomethyl)benzene is 635.6 g/mol.
What is the Canonical SMILES representation of Hexakis(bromomethyl)benzene?
The Canonical SMILES representation of Hexakis(bromomethyl)benzene is C(C1=C(C(=C(C(=C1CBr)CBr)CBr)CBr)CBr)Br.
What is the InChIKey of Hexakis(bromomethyl)benzene?
The InChIKey of Hexakis(bromomethyl)benzene is XJOUCILNLRXRTF-UHFFFAOYSA-N.
How many rotatable bond counts are there in Hexakis(bromomethyl)benzene?
There are 6 rotatable bond counts in Hexakis(bromomethyl)benzene.
What is the topological polar surface area of Hexakis(bromomethyl)benzene?
The topological polar surface area of Hexakis(bromomethyl)benzene is 0Ų.
How many defined atom stereocenter counts are there in Hexakis(bromomethyl)benzene?
There are 0 defined atom stereocenter counts in Hexakis(bromomethyl)benzene.
What is the formal charge of Hexakis(bromomethyl)benzene?
The formal charge of Hexakis(bromomethyl)benzene is 0.
Recommended Products
