What is the molecular formula of Glyphosate, N-(phosphonomethyl)-, potassium salt?
The molecular formula is C3H7KNO5P.
What is the molecular weight of Glyphosate, N-(phosphonomethyl)-, potassium salt?
The molecular weight is 207.16 g/mol.
What is the IUPAC name of Glyphosate, N-(phosphonomethyl)-, potassium salt?
The IUPAC name is potassium;(carboxymethylamino)methyl-hydroxyphosphinate.
What is the InChIKey of Glyphosate, N-(phosphonomethyl)-, potassium salt?
The InChIKey is LIOPHZNMBKHGAV-UHFFFAOYSA-M.
What is the canonical SMILES of Glyphosate, N-(phosphonomethyl)-, potassium salt?
The canonical SMILES is C(C(=O)O)NCP(=O)(O)[O-].[K+].
What is the CAS number of Glyphosate, N-(phosphonomethyl)-, potassium salt?
The CAS number is 39600-42-5.
How many Hydrogen Bond Donor Count does Glyphosate, N-(phosphonomethyl)-, potassium salt have?
It has 3 Hydrogen Bond Donor Counts.
What is the Heavy Atom Count of Glyphosate, N-(phosphonomethyl)-, potassium salt?
The Heavy Atom Count is 11.
Is Glyphosate, N-(phosphonomethyl)-, potassium salt a Covalently-Bonded Unit?
Yes, it is a Covalently-Bonded Unit.
When was Glyphosate, N-(phosphonomethyl)-, potassium salt last modified?
It was last modified on December 30, 2023.